C7H5NOS2 — CID 133057843
5-aminothieno[2,3-b]thiophene-3-carbaldehyde (PubChem CID 133057843) has the molecular formula C7H5NOS2 and a molecular weight of 183.26 g/mol. Its IUPAC name is 5-aminothieno[2,3-b]thiophene-3-carbaldehyde.
| Compound Name | 5-aminothieno[2,3-b]thiophene-3-carbaldehyde |
|---|---|
| PubChem CID | 133057843 |
| Molecular Formula | C7H5NOS2 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 182.98 |
| IUPAC Name | 5-aminothieno[2,3-b]thiophene-3-carbaldehyde |
| SMILES | Nc1cc2c(C=O)csc2s1 |
| InChI | InChI=1S/C7H5NOS2/c8-6-1-5-4(2-9)3-10-7(5)11-6/h1-3H,8H2 |
| InChIKey | SZSWXRWQDIMJCH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|