C10H10N2O4S — CID 133058196
3-hydroxy-1-methylsulfonylindole-2-carboxamide (PubChem CID 133058196) has the molecular formula C10H10N2O4S and a molecular weight of 254.27 g/mol. Its IUPAC name is 3-hydroxy-1-methylsulfonylindole-2-carboxamide.
| Compound Name | 3-hydroxy-1-methylsulfonylindole-2-carboxamide |
|---|---|
| PubChem CID | 133058196 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-hydroxy-1-methylsulfonylindole-2-carboxamide |
| SMILES | CS(=O)(=O)n1c(C(N)=O)c(O)c2ccccc21 |
| InChI | InChI=1S/C10H10N2O4S/c1-17(15,16)12-7-5-3-2-4-6(7)9(13)8(12)10(11)14/h2-5,13H,1H3,(H2,11,14) |
| InChIKey | AXNGRUWWVKJWSG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |