C17H22N4O2 — CID 133059522
tert-butyl 4-quinazolin-8-ylpiperazine-1-carboxylate (PubChem CID 133059522) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is tert-butyl 4-quinazolin-8-ylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-quinazolin-8-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 133059522 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tert-butyl 4-quinazolin-8-ylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc3cncnc23)CC1 |
| InChI | InChI=1S/C17H22N4O2/c1-17(2,3)23-16(22)21-9-7-20(8-10-21)14-6-4-5-13-11-18-12-19-15(13)14/h4-6,11-12H,7-10H2,1-3H3 |
| InChIKey | CFSILWICOPZKTB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |