About 5-bromothieno[2,3-b]thiophene-3-carbonitrile
5-bromothieno[2,3-b]thiophene-3-carbonitrile (PubChem CID 133059565) has the molecular formula C7H2BrNS2
and a molecular weight of 244.14 g/mol. Its IUPAC name is 5-bromothieno[2,3-b]thiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 5-bromothieno[2,3-b]thiophene-3-carbonitrile |
| PubChem CID | 133059565 |
| Molecular Formula | C7H2BrNS2 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 242.88 |
| IUPAC Name | 5-bromothieno[2,3-b]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc2sc(Br)cc12 |
| InChI | InChI=1S/C7H2BrNS2/c8-6-1-5-4(2-9)3-10-7(5)11-6/h1,3H |
| InChIKey | WIGNJABAZFQLKP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromothieno[2,3-b]thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromothieno[2,3-b]thiophene-3-carbonitrile?
The IUPAC name of 5-bromothieno[2,3-b]thiophene-3-carbonitrile (CID 133059565) is 5-bromothieno[2,3-b]thiophene-3-carbonitrile.
What is the SMILES notation for 5-bromothieno[2,3-b]thiophene-3-carbonitrile?
The canonical SMILES for 5-bromothieno[2,3-b]thiophene-3-carbonitrile is N#Cc1csc2sc(Br)cc12.
What is the InChIKey of 5-bromothieno[2,3-b]thiophene-3-carbonitrile?
The InChIKey is WIGNJABAZFQLKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2BrNS2/c8-6-1-5-4(2-9)3-10-7(5)11-6/h1,3H.
What are the key properties of 5-bromothieno[2,3-b]thiophene-3-carbonitrile?
5-bromothieno[2,3-b]thiophene-3-carbonitrile has a molecular weight of 244.14 g/mol, XLogP of 3.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromothieno[2,3-b]thiophene-3-carbonitrile is sourced from PubChem (CID 133059565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).