About (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine
(6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine (PubChem CID 133059794) has the molecular formula C7H7BrN4
and a molecular weight of 227.06 g/mol. Its IUPAC name is (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine.
Molecular Properties
| Compound Name | (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine |
| PubChem CID | 133059794 |
| Molecular Formula | C7H7BrN4 |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine |
| SMILES | NCc1cc(Br)nc2[nH]ncc12 |
| InChI | InChI=1S/C7H7BrN4/c8-6-1-4(2-9)5-3-10-12-7(5)11-6/h1,3H,2,9H2,(H,10,11,12) |
| InChIKey | BZXDQRNBRPYBNY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine?
The IUPAC name of (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine (CID 133059794) is (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine.
What is the SMILES notation for (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine?
The canonical SMILES for (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine is NCc1cc(Br)nc2[nH]ncc12.
What is the InChIKey of (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine?
The InChIKey is BZXDQRNBRPYBNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN4/c8-6-1-4(2-9)5-3-10-12-7(5)11-6/h1,3H,2,9H2,(H,10,11,12).
What are the key properties of (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine?
(6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine has a molecular weight of 227.06 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-1H-pyrazolo[5,4-b]pyridin-4-yl)methanamine is sourced from PubChem (CID 133059794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).