C9H13N3O — CID 133061297
5-cyclopropyloxy-N,N-dimethylpyrazin-2-amine (PubChem CID 133061297) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 5-cyclopropyloxy-N,N-dimethylpyrazin-2-amine.
| Compound Name | 5-cyclopropyloxy-N,N-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 133061297 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-cyclopropyloxy-N,N-dimethylpyrazin-2-amine |
| SMILES | CN(C)c1cnc(OC2CC2)cn1 |
| InChI | InChI=1S/C9H13N3O/c1-12(2)8-5-11-9(6-10-8)13-7-3-4-7/h5-7H,3-4H2,1-2H3 |
| InChIKey | INUVWROVIMVVFC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |