C8H11ClN2 — CID 133061396
6-chloro-1,2,3,4,4a,8a-hexahydrocinnoline (PubChem CID 133061396) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 6-chloro-1,2,3,4,4a,8a-hexahydrocinnoline.
| Compound Name | 6-chloro-1,2,3,4,4a,8a-hexahydrocinnoline |
|---|---|
| PubChem CID | 133061396 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 6-chloro-1,2,3,4,4a,8a-hexahydrocinnoline |
| SMILES | ClC1=CC2CCNNC2C=C1 |
| InChI | InChI=1S/C8H11ClN2/c9-7-1-2-8-6(5-7)3-4-10-11-8/h1-2,5-6,8,10-11H,3-4H2 |
| InChIKey | VVDGCQZKKKWDKY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |