About ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid
ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 133062014) has the molecular formula C10H14F3NO5
and a molecular weight of 285.22 g/mol. Its IUPAC name is ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid |
| PubChem CID | 133062014 |
| Molecular Formula | C10H14F3NO5 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)C1CCNCC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H13NO3.C2HF3O2/c1-2-12-8(11)6-3-4-9-5-7(6)10;3-2(4,5)1(6)7/h6,9H,2-5H2,1H3;(H,6,7) |
| InChIKey | OZGFXDLDZWJQEI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid?
The IUPAC name of ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid (CID 133062014) is ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid?
The canonical SMILES for ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid is CCOC(=O)C1CCNCC1=O.O=C(O)C(F)(F)F.
What is the InChIKey of ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid?
The InChIKey is OZGFXDLDZWJQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3.C2HF3O2/c1-2-12-8(11)6-3-4-9-5-7(6)10;3-2(4,5)1(6)7/h6,9H,2-5H2,1H3;(H,6,7).
What are the key properties of ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid?
ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid has a molecular weight of 285.22 g/mol, XLogP of 0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxopiperidine-4-carboxylate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 133062014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).