About 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one
5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one (PubChem CID 133063272) has the molecular formula C9H11IN2OS
and a molecular weight of 322.17 g/mol. Its IUPAC name is 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one.
Molecular Properties
| Compound Name | 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one |
| PubChem CID | 133063272 |
| Molecular Formula | C9H11IN2OS |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one |
| SMILES | CC(C)(C)N1Cc2nc(I)sc2C1=O |
| InChI | InChI=1S/C9H11IN2OS/c1-9(2,3)12-4-5-6(7(12)13)14-8(10)11-5/h4H2,1-3H3 |
| InChIKey | PBDFFYDMWIQJSC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one?
The IUPAC name of 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one (CID 133063272) is 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one.
What is the SMILES notation for 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one?
The canonical SMILES for 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one is CC(C)(C)N1Cc2nc(I)sc2C1=O.
What is the InChIKey of 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one?
The InChIKey is PBDFFYDMWIQJSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11IN2OS/c1-9(2,3)12-4-5-6(7(12)13)14-8(10)11-5/h4H2,1-3H3.
What are the key properties of 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one?
5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one has a molecular weight of 322.17 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-iodo-4H-pyrrolo[3,4-d][1,3]thiazol-6-one is sourced from PubChem (CID 133063272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).