About 3-ethenyl-5-iodopyridine
3-ethenyl-5-iodopyridine (PubChem CID 133063601) has the molecular formula C7H6IN
and a molecular weight of 231.04 g/mol. Its IUPAC name is 3-ethenyl-5-iodopyridine.
Molecular Properties
| Compound Name | 3-ethenyl-5-iodopyridine |
| PubChem CID | 133063601 |
| Molecular Formula | C7H6IN |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 3-ethenyl-5-iodopyridine |
| SMILES | C=Cc1cncc(I)c1 |
| InChI | InChI=1S/C7H6IN/c1-2-6-3-7(8)5-9-4-6/h2-5H,1H2 |
| InChIKey | FPJYXQBALBUZPT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-5-iodopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-5-iodopyridine?
The IUPAC name of 3-ethenyl-5-iodopyridine (CID 133063601) is 3-ethenyl-5-iodopyridine.
What is the SMILES notation for 3-ethenyl-5-iodopyridine?
The canonical SMILES for 3-ethenyl-5-iodopyridine is C=Cc1cncc(I)c1.
What is the InChIKey of 3-ethenyl-5-iodopyridine?
The InChIKey is FPJYXQBALBUZPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6IN/c1-2-6-3-7(8)5-9-4-6/h2-5H,1H2.
What are the key properties of 3-ethenyl-5-iodopyridine?
3-ethenyl-5-iodopyridine has a molecular weight of 231.04 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-5-iodopyridine is sourced from PubChem (CID 133063601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).