C5H2ClIN4 — CID 133063746
6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 133063746) has the molecular formula C5H2ClIN4 and a molecular weight of 280.46 g/mol. Its IUPAC name is 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 133063746 |
| Molecular Formula | C5H2ClIN4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 279.90 |
| IUPAC Name | 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Clc1cn2c(I)nnc2cn1 |
| InChI | InChI=1S/C5H2ClIN4/c6-3-2-11-4(1-8-3)9-10-5(11)7/h1-2H |
| InChIKey | NYHOLCOJHJUEQL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|