About 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine
6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 133063746) has the molecular formula C5H2ClIN4
and a molecular weight of 280.46 g/mol. Its IUPAC name is 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine.
Molecular Properties
| Compound Name | 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine |
| PubChem CID | 133063746 |
| Molecular Formula | C5H2ClIN4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 279.90 |
| IUPAC Name | 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Clc1cn2c(I)nnc2cn1 |
| InChI | InChI=1S/C5H2ClIN4/c6-3-2-11-4(1-8-3)9-10-5(11)7/h1-2H |
| InChIKey | NYHOLCOJHJUEQL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine?
The IUPAC name of 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine (CID 133063746) is 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine.
What is the SMILES notation for 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine?
The canonical SMILES for 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine is Clc1cn2c(I)nnc2cn1.
What is the InChIKey of 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine?
The InChIKey is NYHOLCOJHJUEQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2ClIN4/c6-3-2-11-4(1-8-3)9-10-5(11)7/h1-2H.
What are the key properties of 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine?
6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine has a molecular weight of 280.46 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-iodo-[1,2,4]triazolo[4,3-a]pyrazine is sourced from PubChem (CID 133063746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).