About 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid
4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 133064019) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 133064019 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | NC1=CCC(C(=O)O)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C7H8N2O4/c8-5-1-3-7(4-2-5,6(10)11)9(12)13/h1-3H,4,8H2,(H,10,11) |
| InChIKey | SEXRQJLCVWGQHG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid (CID 133064019) is 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid is NC1=CCC(C(=O)O)([N+](=O)[O-])C=C1.
What is the InChIKey of 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is SEXRQJLCVWGQHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c8-5-1-3-7(4-2-5,6(10)11)9(12)13/h1-3H,4,8H2,(H,10,11).
What are the key properties of 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid?
4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 184.15 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-nitrocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 133064019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).