C6H6F3NO4 — CID 133064040
ethyl (Z)-4,4,4-trifluoro-2-nitrobut-2-enoate (PubChem CID 133064040) has the molecular formula C6H6F3NO4 and a molecular weight of 213.11 g/mol. Its IUPAC name is ethyl (Z)-4,4,4-trifluoro-2-nitrobut-2-enoate.
| Compound Name | ethyl (Z)-4,4,4-trifluoro-2-nitrobut-2-enoate |
|---|---|
| PubChem CID | 133064040 |
| Molecular Formula | C6H6F3NO4 |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | ethyl (Z)-4,4,4-trifluoro-2-nitrobut-2-enoate |
| SMILES | CCOC(=O)/C(=C/C(F)(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C6H6F3NO4/c1-2-14-5(11)4(10(12)13)3-6(7,8)9/h3H,2H2,1H3/b4-3- |
| InChIKey | AEKQCWKISTWWPL-ARJAWSKDSA-N |
| XLogP | 1.27 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|