C13H15NO3S2 — CID 133064143
(2R,4R)-2-ethyl-3-(2-sulfanylbenzoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 133064143) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2R,4R)-2-ethyl-3-(2-sulfanylbenzoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4R)-2-ethyl-3-(2-sulfanylbenzoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 133064143 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | (2R,4R)-2-ethyl-3-(2-sulfanylbenzoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC[C@H]1SC[C@@H](C(=O)O)N1C(=O)c1ccccc1S |
| InChI | InChI=1S/C13H15NO3S2/c1-2-11-14(9(7-19-11)13(16)17)12(15)8-5-3-4-6-10(8)18/h3-6,9,11,18H,2,7H2,1H3,(H,16,17)/t9-,11+/m0/s1 |
| InChIKey | BSUSEWAWDKOUTJ-GXSJLCMTSA-N |
| XLogP | 2.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|