C14H15F7N2O3S — CID 133064146
4-[6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylsulfanylpyrimidin-4-yl]oxybutyl acetate (PubChem CID 133064146) has the molecular formula C14H15F7N2O3S and a molecular weight of 424.34 g/mol. Its IUPAC name is 4-[6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylsulfanylpyrimidin-4-yl]oxybutyl acetate.
| Compound Name | 4-[6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylsulfanylpyrimidin-4-yl]oxybutyl acetate |
|---|---|
| PubChem CID | 133064146 |
| Molecular Formula | C14H15F7N2O3S |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 4-[6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylsulfanylpyrimidin-4-yl]oxybutyl acetate |
| SMILES | CSc1nc(OCCCCOC(C)=O)cc(C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H15F7N2O3S/c1-8(24)25-5-3-4-6-26-10-7-9(22-11(23-10)27-2)12(15,16)13(17,18)14(19,20)21/h7H,3-6H2,1-2H3 |
| InChIKey | UIBBEKBXLZQVEJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|