C18H16F3NO2 — CID 133064266
2,2,2-trifluoro-N-[(E)-2-hydroxy-1,4-diphenylbut-3-enyl]acetamide (PubChem CID 133064266) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(E)-2-hydroxy-1,4-diphenylbut-3-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(E)-2-hydroxy-1,4-diphenylbut-3-enyl]acetamide |
|---|---|
| PubChem CID | 133064266 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[(E)-2-hydroxy-1,4-diphenylbut-3-enyl]acetamide |
| SMILES | O=C(NC(c1ccccc1)C(O)/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H16F3NO2/c19-18(20,21)17(24)22-16(14-9-5-2-6-10-14)15(23)12-11-13-7-3-1-4-8-13/h1-12,15-16,23H,(H,22,24)/b12-11+ |
| InChIKey | RQTVJZVSQLFCFX-VAWYXSNFSA-N |
| XLogP | 3.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |