C16H8N2O2S2 — CID 133064581
5,15-dithia-9,19-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),6,11,14(18),16-heptaene-10,20-dione (PubChem CID 133064581) has the molecular formula C16H8N2O2S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is 5,15-dithia-9,19-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),6,11,14(18),16-heptaene-10,20-dione.
| Compound Name | 5,15-dithia-9,19-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),6,11,14(18),16-heptaene-10,20-dione |
|---|---|
| PubChem CID | 133064581 |
| Molecular Formula | C16H8N2O2S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 5,15-dithia-9,19-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),6,11,14(18),16-heptaene-10,20-dione |
| SMILES | O=c1[nH]c2ccsc2c2cc3c(=O)[nH]c4ccsc4c3cc12 |
| InChI | InChI=1S/C16H8N2O2S2/c19-15-9-6-8-10(16(20)18-12-2-4-22-14(8)12)5-7(9)13-11(17-15)1-3-21-13/h1-6H,(H,17,19)(H,18,20) |
| InChIKey | YAOMHPHFHSIVQC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|