C34H28F5OSb — CID 133064666
tetrakis(4-methylphenyl)-(2,3,4,5,6-pentafluorophenoxy)-λ5-stibane (PubChem CID 133064666) has the molecular formula C34H28F5OSb and a molecular weight of 669.35 g/mol. Its IUPAC name is tetrakis(4-methylphenyl)-(2,3,4,5,6-pentafluorophenoxy)-λ5-stibane.
| Compound Name | tetrakis(4-methylphenyl)-(2,3,4,5,6-pentafluorophenoxy)-λ5-stibane |
|---|---|
| PubChem CID | 133064666 |
| Molecular Formula | C34H28F5OSb |
| Molecular Weight | 669.35 g/mol |
| Exact Mass | 668.11 |
| IUPAC Name | tetrakis(4-methylphenyl)-(2,3,4,5,6-pentafluorophenoxy)-λ5-stibane |
| SMILES | Cc1ccc([Sb](Oc2c(F)c(F)c(F)c(F)c2F)(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/4C7H7.C6HF5O.Sb/c4*1-7-5-3-2-4-6-7;7-1-2(8)4(10)6(12)5(11)3(1)9;/h4*3-6H,1H3;12H;/q;;;;;+1/p-1 |
| InChIKey | JSFCXBIZBDCMNP-UHFFFAOYSA-M |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.35 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|