About 1,5-diphenyltetrazole;hydrobromide
1,5-diphenyltetrazole;hydrobromide (PubChem CID 133064702) has the molecular formula C13H11BrN4
and a molecular weight of 303.16 g/mol. Its IUPAC name is 1,5-diphenyltetrazole;hydrobromide.
Molecular Properties
| Compound Name | 1,5-diphenyltetrazole;hydrobromide |
| PubChem CID | 133064702 |
| Molecular Formula | C13H11BrN4 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 1,5-diphenyltetrazole;hydrobromide |
| SMILES | Br.c1ccc(-c2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10N4.BrH/c1-3-7-11(8-4-1)13-14-15-16-17(13)12-9-5-2-6-10-12;/h1-10H;1H |
| InChIKey | PFKYCGAUNWCWNO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-diphenyltetrazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diphenyltetrazole;hydrobromide?
The IUPAC name of 1,5-diphenyltetrazole;hydrobromide (CID 133064702) is 1,5-diphenyltetrazole;hydrobromide.
What is the SMILES notation for 1,5-diphenyltetrazole;hydrobromide?
The canonical SMILES for 1,5-diphenyltetrazole;hydrobromide is Br.c1ccc(-c2nnnn2-c2ccccc2)cc1.
What is the InChIKey of 1,5-diphenyltetrazole;hydrobromide?
The InChIKey is PFKYCGAUNWCWNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4.BrH/c1-3-7-11(8-4-1)13-14-15-16-17(13)12-9-5-2-6-10-12;/h1-10H;1H.
What are the key properties of 1,5-diphenyltetrazole;hydrobromide?
1,5-diphenyltetrazole;hydrobromide has a molecular weight of 303.16 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diphenyltetrazole;hydrobromide is sourced from PubChem (CID 133064702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).