About benzyl N-(1,2,4-triazol-4-yl)carbamodithioate
benzyl N-(1,2,4-triazol-4-yl)carbamodithioate (PubChem CID 133064825) has the molecular formula C10H10N4S2
and a molecular weight of 250.35 g/mol. Its IUPAC name is benzyl N-(1,2,4-triazol-4-yl)carbamodithioate.
Molecular Properties
| Compound Name | benzyl N-(1,2,4-triazol-4-yl)carbamodithioate |
| PubChem CID | 133064825 |
| Molecular Formula | C10H10N4S2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | benzyl N-(1,2,4-triazol-4-yl)carbamodithioate |
| SMILES | S=C(Nn1cnnc1)SCc1ccccc1 |
| InChI | InChI=1S/C10H10N4S2/c15-10(13-14-7-11-12-8-14)16-6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H,13,15) |
| InChIKey | KIUOUEMNUSBJPN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-(1,2,4-triazol-4-yl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-(1,2,4-triazol-4-yl)carbamodithioate?
The IUPAC name of benzyl N-(1,2,4-triazol-4-yl)carbamodithioate (CID 133064825) is benzyl N-(1,2,4-triazol-4-yl)carbamodithioate.
What is the SMILES notation for benzyl N-(1,2,4-triazol-4-yl)carbamodithioate?
The canonical SMILES for benzyl N-(1,2,4-triazol-4-yl)carbamodithioate is S=C(Nn1cnnc1)SCc1ccccc1.
What is the InChIKey of benzyl N-(1,2,4-triazol-4-yl)carbamodithioate?
The InChIKey is KIUOUEMNUSBJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4S2/c15-10(13-14-7-11-12-8-14)16-6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H,13,15).
What are the key properties of benzyl N-(1,2,4-triazol-4-yl)carbamodithioate?
benzyl N-(1,2,4-triazol-4-yl)carbamodithioate has a molecular weight of 250.35 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(1,2,4-triazol-4-yl)carbamodithioate is sourced from PubChem (CID 133064825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).