C36H24Cl2N6O3 — CID 133064844
1-(2,6-dichloro-4-nitrophenyl)-4-[[4-(1,4,5-triphenylimidazol-2-yl)phenoxy]methyl]triazole (PubChem CID 133064844) has the molecular formula C36H24Cl2N6O3 and a molecular weight of 659.53 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)-4-[[4-(1,4,5-triphenylimidazol-2-yl)phenoxy]methyl]triazole.
| Compound Name | 1-(2,6-dichloro-4-nitrophenyl)-4-[[4-(1,4,5-triphenylimidazol-2-yl)phenoxy]methyl]triazole |
|---|---|
| PubChem CID | 133064844 |
| Molecular Formula | C36H24Cl2N6O3 |
| Molecular Weight | 659.53 g/mol |
| Exact Mass | 658.13 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenyl)-4-[[4-(1,4,5-triphenylimidazol-2-yl)phenoxy]methyl]triazole |
| SMILES | O=[N+]([O-])c1cc(Cl)c(-n2cc(COc3ccc(-c4nc(-c5ccccc5)c(-c5ccccc5)n4-c4ccccc4)cc3)nn2)c(Cl)c1 |
| InChI | InChI=1S/C36H24Cl2N6O3/c37-31-20-29(44(45)46)21-32(38)35(31)42-22-27(40-41-42)23-47-30-18-16-26(17-19-30)36-39-33(24-10-4-1-5-11-24)34(25-12-6-2-7-13-25)43(36)28-14-8-3-9-15-28/h1-22H,23H2 |
| InChIKey | CPRUQSJRPKBHGP-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.53 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|