About chlorohydrazine;phthalazine
chlorohydrazine;phthalazine (PubChem CID 133064965) has the molecular formula C8H9ClN4
and a molecular weight of 196.64 g/mol. Its IUPAC name is chlorohydrazine;phthalazine.
Molecular Properties
| Compound Name | chlorohydrazine;phthalazine |
| PubChem CID | 133064965 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | chlorohydrazine;phthalazine |
| SMILES | NNCl.c1ccc2cnncc2c1 |
| InChI | InChI=1S/C8H6N2.ClH3N2/c1-2-4-8-6-10-9-5-7(8)3-1;1-3-2/h1-6H;3H,2H2 |
| InChIKey | IAOROAHTNZYAHV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze chlorohydrazine;phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorohydrazine;phthalazine?
The IUPAC name of chlorohydrazine;phthalazine (CID 133064965) is chlorohydrazine;phthalazine.
What is the SMILES notation for chlorohydrazine;phthalazine?
The canonical SMILES for chlorohydrazine;phthalazine is NNCl.c1ccc2cnncc2c1.
What is the InChIKey of chlorohydrazine;phthalazine?
The InChIKey is IAOROAHTNZYAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.ClH3N2/c1-2-4-8-6-10-9-5-7(8)3-1;1-3-2/h1-6H;3H,2H2.
What are the key properties of chlorohydrazine;phthalazine?
chlorohydrazine;phthalazine has a molecular weight of 196.64 g/mol, XLogP of 1.23, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chlorohydrazine;phthalazine is sourced from PubChem (CID 133064965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).