About 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene
1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene (PubChem CID 133064975) has the molecular formula C26H40O2Si2
and a molecular weight of 440.78 g/mol.
Molecular Properties
| Compound Name | 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene |
| PubChem CID | 133064975 |
| Molecular Formula | C26H40O2Si2 |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | — |
| SMILES | CC(C[Si](C)c1ccc([Si](C)CC(C)C2CCC3OC3C2)cc1)C1CCC2OC2C1 |
| InChI | InChI=1S/C26H40O2Si2/c1-17(19-5-11-23-25(13-19)27-23)15-29(3)21-7-9-22(10-8-21)30(4)16-18(2)20-6-12-24-26(14-20)28-24/h7-10,17-20,23-26H,5-6,11-16H2,1-4H3 |
| InChIKey | QVLDIFYBVKQNPN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene?
The IUPAC name of 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene (CID 133064975) is not available.
What is the SMILES notation for 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene?
The canonical SMILES for 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene is CC(C[Si](C)c1ccc([Si](C)CC(C)C2CCC3OC3C2)cc1)C1CCC2OC2C1.
What is the InChIKey of 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene?
The InChIKey is QVLDIFYBVKQNPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H40O2Si2/c1-17(19-5-11-23-25(13-19)27-23)15-29(3)21-7-9-22(10-8-21)30(4)16-18(2)20-6-12-24-26(14-20)28-24/h7-10,17-20,23-26H,5-6,11-16H2,1-4H3.
What are the key properties of 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene?
1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene has a molecular weight of 440.78 g/mol, XLogP of 4.76, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[2-(3,4-epoxycyclohexylethyl)dimethylsilyl]benzene is sourced from PubChem (CID 133064975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).