C19H19NO3S2 — CID 133065061
(2R,4R)-2-(2-phenylethyl)-3-(2-sulfanylbenzoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 133065061) has the molecular formula C19H19NO3S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (2R,4R)-2-(2-phenylethyl)-3-(2-sulfanylbenzoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4R)-2-(2-phenylethyl)-3-(2-sulfanylbenzoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 133065061 |
| Molecular Formula | C19H19NO3S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | (2R,4R)-2-(2-phenylethyl)-3-(2-sulfanylbenzoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CS[C@H](CCc2ccccc2)N1C(=O)c1ccccc1S |
| InChI | InChI=1S/C19H19NO3S2/c21-18(14-8-4-5-9-16(14)24)20-15(19(22)23)12-25-17(20)11-10-13-6-2-1-3-7-13/h1-9,15,17,24H,10-12H2,(H,22,23)/t15-,17+/m0/s1 |
| InChIKey | YEFCGBQPIOPYDB-DOTOQJQBSA-N |
| XLogP | 3.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|