C10H12F6N2O2 — CID 133065082
N-[(E)-2,3-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]but-2-enyl]-2,2,2-trifluoroacetamide (PubChem CID 133065082) has the molecular formula C10H12F6N2O2 and a molecular weight of 306.21 g/mol. Its IUPAC name is N-[(E)-2,3-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]but-2-enyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E)-2,3-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]but-2-enyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 133065082 |
| Molecular Formula | C10H12F6N2O2 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-[(E)-2,3-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]but-2-enyl]-2,2,2-trifluoroacetamide |
| SMILES | C/C(CNC(=O)C(F)(F)F)=C(/C)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F6N2O2/c1-5(3-17-7(19)9(11,12)13)6(2)4-18-8(20)10(14,15)16/h3-4H2,1-2H3,(H,17,19)(H,18,20)/b6-5+ |
| InChIKey | BNEXCBHFWFUXFO-AATRIKPKSA-N |
| XLogP | 1.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|