About 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene
2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene (PubChem CID 133065156) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene.
Molecular Properties
| Compound Name | 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene |
| PubChem CID | 133065156 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene |
| SMILES | CC1=C2CCC(=C1C)C2 |
| InChI | InChI=1S/C9H12/c1-6-7(2)9-4-3-8(6)5-9/h3-5H2,1-2H3 |
| InChIKey | NYAPPKXLNORANH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene?
The IUPAC name of 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene (CID 133065156) is 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene.
What is the SMILES notation for 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene?
The canonical SMILES for 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene is CC1=C2CCC(=C1C)C2.
What is the InChIKey of 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene?
The InChIKey is NYAPPKXLNORANH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12/c1-6-7(2)9-4-3-8(6)5-9/h3-5H2,1-2H3.
What are the key properties of 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene?
2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene has a molecular weight of 120.19 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbicyclo[2.2.1]hepta-1,3-diene is sourced from PubChem (CID 133065156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).