C22H15ClFN5 — CID 133065448
2-(6-fluoro-2-methyl-1H-indol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline;hydrochloride (PubChem CID 133065448) has the molecular formula C22H15ClFN5 and a molecular weight of 403.85 g/mol. Its IUPAC name is 2-(6-fluoro-2-methyl-1H-indol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline;hydrochloride.
| Compound Name | 2-(6-fluoro-2-methyl-1H-indol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline;hydrochloride |
|---|---|
| PubChem CID | 133065448 |
| Molecular Formula | C22H15ClFN5 |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-(6-fluoro-2-methyl-1H-indol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline;hydrochloride |
| SMILES | Cc1[nH]c2cc(F)ccc2c1-c1nc2c3cccnc3c3ncccc3c2[nH]1.Cl |
| InChI | InChI=1S/C22H14FN5.ClH/c1-11-17(13-7-6-12(23)10-16(13)26-11)22-27-20-14-4-2-8-24-18(14)19-15(21(20)28-22)5-3-9-25-19;/h2-10,26H,1H3,(H,27,28);1H |
| InChIKey | DCTZFBNDUHPMQU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|