About 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide
1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide (PubChem CID 133065460) has the molecular formula C13H20IN4+
and a molecular weight of 359.24 g/mol. Its IUPAC name is 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide.
Molecular Properties
| Compound Name | 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide |
| PubChem CID | 133065460 |
| Molecular Formula | C13H20IN4+ |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide |
| SMILES | I.c1ccc(C[N+]23CN4CN(CN(C4)C2)C3)cc1 |
| InChI | InChI=1S/C13H19N4.HI/c1-2-4-13(5-3-1)6-17-10-14-7-15(11-17)9-16(8-14)12-17;/h1-5H,6-12H2;1H/q+1; |
| InChIKey | VICXMJRXQMOEIY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide?
The IUPAC name of 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide (CID 133065460) is 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide.
What is the SMILES notation for 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide?
The canonical SMILES for 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide is I.c1ccc(C[N+]23CN4CN(CN(C4)C2)C3)cc1.
What is the InChIKey of 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide?
The InChIKey is VICXMJRXQMOEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N4.HI/c1-2-4-13(5-3-1)6-17-10-14-7-15(11-17)9-16(8-14)12-17;/h1-5H,6-12H2;1H/q+1;.
What are the key properties of 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide?
1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide has a molecular weight of 359.24 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane;hydroiodide is sourced from PubChem (CID 133065460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).