C32H43FN4O4 — CID 133066752
(7S)-1'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-7-methylspiro[2-oxa-5,8-diazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-10,4'-piperidine]-6,9-dione (PubChem CID 133066752) has the molecular formula C32H43FN4O4 and a molecular weight of 566.72 g/mol. Its IUPAC name is (7S)-1'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-7-methylspiro[2-oxa-5,8-diazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-10,4'-piperidine]-6,9-dione.
| Compound Name | (7S)-1'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-7-methylspiro[2-oxa-5,8-diazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-10,4'-piperidine]-6,9-dione |
|---|---|
| PubChem CID | 133066752 |
| Molecular Formula | C32H43FN4O4 |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | (7S)-1'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-7-methylspiro[2-oxa-5,8-diazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-10,4'-piperidine]-6,9-dione |
| SMILES | C[C@@H]1NC(=O)C2(CCCCc3ccccc3OCCNC1=O)CCN(Cc1ccc(N3CCOCC3)c(F)c1)CC2 |
| InChI | InChI=1S/C32H43FN4O4/c1-24-30(38)34-14-19-41-29-8-3-2-6-26(29)7-4-5-11-32(31(39)35-24)12-15-36(16-13-32)23-25-9-10-28(27(33)22-25)37-17-20-40-21-18-37/h2-3,6,8-10,22,24H,4-5,7,11-21,23H2,1H3,(H,34,38)(H,35,39)/t24-/m0/s1 |
| InChIKey | SMORTFLUOXZCPD-DEOSSOPVSA-N |
| XLogP | 3.67 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|