C30H29N3O3S — CID 133067066
3-methyl-15-(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one (PubChem CID 133067066) has the molecular formula C30H29N3O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is 3-methyl-15-(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one.
| Compound Name | 3-methyl-15-(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one |
|---|---|
| PubChem CID | 133067066 |
| Molecular Formula | C30H29N3O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 3-methyl-15-(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one |
| SMILES | Cc1nc(C(=O)N2CCCOc3ccccc3C(=O)N(C)Cc3cccc(c3)C2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C30H29N3O3S/c1-21-31-27(28(37-21)24-12-4-3-5-13-24)30(35)33-16-9-17-36-26-15-7-6-14-25(26)29(34)32(2)19-22-10-8-11-23(18-22)20-33/h3-8,10-15,18H,9,16-17,19-20H2,1-2H3 |
| InChIKey | WPTIWMFQFZYMQU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |