C25H36N4O4S — CID 133067665
(3S,8R)-9-(1-ethyl-3,5-dimethylpyrazol-4-yl)sulfonyl-14-methyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one (PubChem CID 133067665) has the molecular formula C25H36N4O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is (3S,8R)-9-(1-ethyl-3,5-dimethylpyrazol-4-yl)sulfonyl-14-methyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one.
| Compound Name | (3S,8R)-9-(1-ethyl-3,5-dimethylpyrazol-4-yl)sulfonyl-14-methyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one |
|---|---|
| PubChem CID | 133067665 |
| Molecular Formula | C25H36N4O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (3S,8R)-9-(1-ethyl-3,5-dimethylpyrazol-4-yl)sulfonyl-14-methyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one |
| SMILES | CCn1nc(C)c(S(=O)(=O)N2CCCCN(C)C(=O)c3ccccc3O[C@H]3CCCC[C@H]32)c1C |
| InChI | InChI=1S/C25H36N4O4S/c1-5-28-19(3)24(18(2)26-28)34(31,32)29-17-11-10-16-27(4)25(30)20-12-6-8-14-22(20)33-23-15-9-7-13-21(23)29/h6,8,12,14,21,23H,5,7,9-11,13,15-17H2,1-4H3/t21-,23+/m1/s1 |
| InChIKey | PHHLGSPSKLJMLQ-GGAORHGYSA-N |
| XLogP | 3.77 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |