C24H37N7O3 — CID 133067860
1'-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]spiro[11-oxa-1,8,14,15-tetrazabicyclo[11.2.1]hexadeca-13(16),14-diene-6,4'-piperidine]-7-one (PubChem CID 133067860) has the molecular formula C24H37N7O3 and a molecular weight of 471.61 g/mol. Its IUPAC name is 1'-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]spiro[11-oxa-1,8,14,15-tetrazabicyclo[11.2.1]hexadeca-13(16),14-diene-6,4'-piperidine]-7-one.
| Compound Name | 1'-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]spiro[11-oxa-1,8,14,15-tetrazabicyclo[11.2.1]hexadeca-13(16),14-diene-6,4'-piperidine]-7-one |
|---|---|
| PubChem CID | 133067860 |
| Molecular Formula | C24H37N7O3 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | 1'-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]spiro[11-oxa-1,8,14,15-tetrazabicyclo[11.2.1]hexadeca-13(16),14-diene-6,4'-piperidine]-7-one |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)N1CCC2(CCCCn3cc(nn3)COCCNC2=O)CC1 |
| InChI | InChI=1S/C24H37N7O3/c1-18-21(19(2)29(3)27-18)6-7-22(32)30-13-9-24(10-14-30)8-4-5-12-31-16-20(26-28-31)17-34-15-11-25-23(24)33/h16H,4-15,17H2,1-3H3,(H,25,33) |
| InChIKey | PYPCWTHVJCFAFV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |