C24H33N5O3 — CID 133069396
1'-[4-(1,2,4-triazol-1-yl)butanoyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,3'-piperidine]-6-one (PubChem CID 133069396) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 1'-[4-(1,2,4-triazol-1-yl)butanoyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,3'-piperidine]-6-one.
| Compound Name | 1'-[4-(1,2,4-triazol-1-yl)butanoyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,3'-piperidine]-6-one |
|---|---|
| PubChem CID | 133069396 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 1'-[4-(1,2,4-triazol-1-yl)butanoyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,3'-piperidine]-6-one |
| SMILES | O=C(CCCn1cncn1)N1CCCC2(CCCCc3ccccc3OCCNC2=O)C1 |
| InChI | InChI=1S/C24H33N5O3/c30-22(10-5-15-29-19-25-18-27-29)28-14-6-12-24(17-28)11-4-3-8-20-7-1-2-9-21(20)32-16-13-26-23(24)31/h1-2,7,9,18-19H,3-6,8,10-17H2,(H,26,31) |
| InChIKey | ULMNHMDPVZXAFG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |