C24H30ClN3O4 — CID 133069529
14-chloro-1'-(3,5-dimethyl-1,2-oxazole-4-carbonyl)spiro[2-oxa-10-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-8,3'-piperidine]-11-one (PubChem CID 133069529) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is 14-chloro-1'-(3,5-dimethyl-1,2-oxazole-4-carbonyl)spiro[2-oxa-10-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-8,3'-piperidine]-11-one.
| Compound Name | 14-chloro-1'-(3,5-dimethyl-1,2-oxazole-4-carbonyl)spiro[2-oxa-10-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-8,3'-piperidine]-11-one |
|---|---|
| PubChem CID | 133069529 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 14-chloro-1'-(3,5-dimethyl-1,2-oxazole-4-carbonyl)spiro[2-oxa-10-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-8,3'-piperidine]-11-one |
| SMILES | Cc1noc(C)c1C(=O)N1CCCC2(CCCCCOc3ccc(Cl)cc3C(=O)NC2)C1 |
| InChI | InChI=1S/C24H30ClN3O4/c1-16-21(17(2)32-27-16)23(30)28-11-6-10-24(15-28)9-4-3-5-12-31-20-8-7-18(25)13-19(20)22(29)26-14-24/h7-8,13H,3-6,9-12,14-15H2,1-2H3,(H,26,29) |
| InChIKey | GXBBYEIDWVVPAV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |