C26H32Cl2N2O4S — CID 133069977
(3S,8R)-9-(2,5-dichlorophenyl)sulfonyl-14-propyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one (PubChem CID 133069977) has the molecular formula C26H32Cl2N2O4S and a molecular weight of 539.53 g/mol. Its IUPAC name is (3S,8R)-9-(2,5-dichlorophenyl)sulfonyl-14-propyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one.
| Compound Name | (3S,8R)-9-(2,5-dichlorophenyl)sulfonyl-14-propyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one |
|---|---|
| PubChem CID | 133069977 |
| Molecular Formula | C26H32Cl2N2O4S |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (3S,8R)-9-(2,5-dichlorophenyl)sulfonyl-14-propyl-2-oxa-9,14-diazatricyclo[14.4.0.03,8]icosa-1(20),16,18-trien-15-one |
| SMILES | CCCN1CCCCN(S(=O)(=O)c2cc(Cl)ccc2Cl)[C@@H]2CCCC[C@@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C26H32Cl2N2O4S/c1-2-15-29-16-7-8-17-30(35(32,33)25-18-19(27)13-14-21(25)28)22-10-4-6-12-24(22)34-23-11-5-3-9-20(23)26(29)31/h3,5,9,11,13-14,18,22,24H,2,4,6-8,10,12,15-17H2,1H3/t22-,24+/m1/s1 |
| InChIKey | TZBSBUPRLIMJKV-VWNXMTODSA-N |
| XLogP | 6.02 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |