C25H27ClN4O5 — CID 133071745
21-chloro-15-(4-pyrazol-1-ylbutanoyl)-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one (PubChem CID 133071745) has the molecular formula C25H27ClN4O5 and a molecular weight of 498.97 g/mol. Its IUPAC name is 21-chloro-15-(4-pyrazol-1-ylbutanoyl)-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one.
| Compound Name | 21-chloro-15-(4-pyrazol-1-ylbutanoyl)-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one |
|---|---|
| PubChem CID | 133071745 |
| Molecular Formula | C25H27ClN4O5 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 21-chloro-15-(4-pyrazol-1-ylbutanoyl)-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one |
| SMILES | O=C1CN(C(=O)CCCn2cccn2)CCOCCOc2ccccc2Oc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C25H27ClN4O5/c26-19-8-9-21-20(17-19)28-24(31)18-29(25(32)7-3-11-30-12-4-10-27-30)13-14-33-15-16-34-22-5-1-2-6-23(22)35-21/h1-2,4-6,8-10,12,17H,3,7,11,13-16,18H2,(H,28,31) |
| InChIKey | ZMWRPOLDIJOCBC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |