C33H36F2N4O3 — CID 133072117
1-[[3-(2-acetyl-6-benzyl-13,14-difluoro-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-triene-9-carbonyl)phenyl]methyl]pyrrolidin-2-one (PubChem CID 133072117) has the molecular formula C33H36F2N4O3 and a molecular weight of 574.67 g/mol. Its IUPAC name is 1-[[3-(2-acetyl-6-benzyl-13,14-difluoro-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-triene-9-carbonyl)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[3-(2-acetyl-6-benzyl-13,14-difluoro-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-triene-9-carbonyl)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 133072117 |
| Molecular Formula | C33H36F2N4O3 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 1-[[3-(2-acetyl-6-benzyl-13,14-difluoro-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-triene-9-carbonyl)phenyl]methyl]pyrrolidin-2-one |
| SMILES | CC(=O)N1CCCN(Cc2ccccc2)CCN(C(=O)c2cccc(CN3CCCC3=O)c2)Cc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C33H36F2N4O3/c1-24(40)39-15-7-13-36(21-25-8-3-2-4-9-25)16-17-38(23-28-19-29(34)30(35)20-31(28)39)33(42)27-11-5-10-26(18-27)22-37-14-6-12-32(37)41/h2-5,8-11,18-20H,6-7,12-17,21-23H2,1H3 |
| InChIKey | OAZQORZXAOXAMZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |