C28H38N2O3 — CID 133072488
(4R)-4-benzyl-5-hexanoyl-11-methyl-2-oxa-5,11-diazabicyclo[11.4.0]heptadeca-1(17),13,15-trien-12-one (PubChem CID 133072488) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is (4R)-4-benzyl-5-hexanoyl-11-methyl-2-oxa-5,11-diazabicyclo[11.4.0]heptadeca-1(17),13,15-trien-12-one.
| Compound Name | (4R)-4-benzyl-5-hexanoyl-11-methyl-2-oxa-5,11-diazabicyclo[11.4.0]heptadeca-1(17),13,15-trien-12-one |
|---|---|
| PubChem CID | 133072488 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | (4R)-4-benzyl-5-hexanoyl-11-methyl-2-oxa-5,11-diazabicyclo[11.4.0]heptadeca-1(17),13,15-trien-12-one |
| SMILES | CCCCCC(=O)N1CCCCCN(C)C(=O)c2ccccc2OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H38N2O3/c1-3-4-7-18-27(31)30-20-13-6-12-19-29(2)28(32)25-16-10-11-17-26(25)33-22-24(30)21-23-14-8-5-9-15-23/h5,8-11,14-17,24H,3-4,6-7,12-13,18-22H2,1-2H3/t24-/m1/s1 |
| InChIKey | DIEDIZZYJUKNCN-XMMPIXPASA-N |
| XLogP | 5.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|