C20H28N4O6 — CID 133072494
(7S,11S)-7-(4-aminobutyl)-5-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxylic acid (PubChem CID 133072494) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is (7S,11S)-7-(4-aminobutyl)-5-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxylic acid.
| Compound Name | (7S,11S)-7-(4-aminobutyl)-5-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxylic acid |
|---|---|
| PubChem CID | 133072494 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (7S,11S)-7-(4-aminobutyl)-5-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxylic acid |
| SMILES | CN1CCOc2ccccc2C(=O)N[C@H](C(=O)O)CC(=O)N[C@@H](CCCCN)C1=O |
| InChI | InChI=1S/C20H28N4O6/c1-24-10-11-30-16-8-3-2-6-13(16)18(26)23-15(20(28)29)12-17(25)22-14(19(24)27)7-4-5-9-21/h2-3,6,8,14-15H,4-5,7,9-12,21H2,1H3,(H,22,25)(H,23,26)(H,28,29)/t14-,15-/m0/s1 |
| InChIKey | XZPULZXWGGBGLH-GJZGRUSLSA-N |
| XLogP | -0.28 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|