C25H38N6O3 — CID 133073137
11-(3-methylbutyl)-9-oxo-N-[3-(1,2,4-triazol-1-yl)propyl]-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(17),13,15-triene-14-carboxamide (PubChem CID 133073137) has the molecular formula C25H38N6O3 and a molecular weight of 470.62 g/mol. Its IUPAC name is 11-(3-methylbutyl)-9-oxo-N-[3-(1,2,4-triazol-1-yl)propyl]-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(17),13,15-triene-14-carboxamide.
| Compound Name | 11-(3-methylbutyl)-9-oxo-N-[3-(1,2,4-triazol-1-yl)propyl]-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(17),13,15-triene-14-carboxamide |
|---|---|
| PubChem CID | 133073137 |
| Molecular Formula | C25H38N6O3 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 11-(3-methylbutyl)-9-oxo-N-[3-(1,2,4-triazol-1-yl)propyl]-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(17),13,15-triene-14-carboxamide |
| SMILES | CC(C)CCN1CC(=O)NCCCCCOc2cccc(C(=O)NCCCn3cncn3)c2C1 |
| InChI | InChI=1S/C25H38N6O3/c1-20(2)10-14-30-16-22-21(25(33)28-12-7-13-31-19-26-18-29-31)8-6-9-23(22)34-15-5-3-4-11-27-24(32)17-30/h6,8-9,18-20H,3-5,7,10-17H2,1-2H3,(H,27,32)(H,28,33) |
| InChIKey | XIRYGPDZQATHAQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|