C37H41FN4O4 — CID 133073267
5-(6-fluoro-3-pyridinyl)-12-[[4-hydroxy-1-(2-methoxyphenyl)piperidin-4-yl]methyl]-15-methyl-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one (PubChem CID 133073267) has the molecular formula C37H41FN4O4 and a molecular weight of 624.76 g/mol. Its IUPAC name is 5-(6-fluoro-3-pyridinyl)-12-[[4-hydroxy-1-(2-methoxyphenyl)piperidin-4-yl]methyl]-15-methyl-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one.
| Compound Name | 5-(6-fluoro-3-pyridinyl)-12-[[4-hydroxy-1-(2-methoxyphenyl)piperidin-4-yl]methyl]-15-methyl-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one |
|---|---|
| PubChem CID | 133073267 |
| Molecular Formula | C37H41FN4O4 |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | 5-(6-fluoro-3-pyridinyl)-12-[[4-hydroxy-1-(2-methoxyphenyl)piperidin-4-yl]methyl]-15-methyl-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one |
| SMILES | COc1ccccc1N1CCC(O)(CN2CCOc3ccc(-c4ccc(F)nc4)cc3Cc3cccc(c3)C(=O)N(C)CC2)CC1 |
| InChI | InChI=1S/C37H41FN4O4/c1-40-18-19-41(26-37(44)14-16-42(17-15-37)32-8-3-4-9-34(32)45-2)20-21-46-33-12-10-28(30-11-13-35(38)39-25-30)24-31(33)23-27-6-5-7-29(22-27)36(40)43/h3-13,22,24-25,44H,14-21,23,26H2,1-2H3 |
| InChIKey | MNHCSIQFYDMUSS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|