C26H29ClN4O4 — CID 133073616
6-chloro-12-[3-(2-methylimidazol-1-yl)propanoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one (PubChem CID 133073616) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is 6-chloro-12-[3-(2-methylimidazol-1-yl)propanoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one.
| Compound Name | 6-chloro-12-[3-(2-methylimidazol-1-yl)propanoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
|---|---|
| PubChem CID | 133073616 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 6-chloro-12-[3-(2-methylimidazol-1-yl)propanoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
| SMILES | Cc1nccn1CCC(=O)N1CCCCCOc2ccccc2Oc2ccc(Cl)cc2NC(=O)C1 |
| InChI | InChI=1S/C26H29ClN4O4/c1-19-28-12-15-30(19)14-11-26(33)31-13-5-2-6-16-34-23-7-3-4-8-24(23)35-22-10-9-20(27)17-21(22)29-25(32)18-31/h3-4,7-10,12,15,17H,2,5-6,11,13-14,16,18H2,1H3,(H,29,32) |
| InChIKey | RHYDHNGTUMMFPE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |