About 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane
2-cyclopenta-1,3-dien-1-yl-2-methyloxolane (PubChem CID 13307757) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane.
Molecular Properties
| Compound Name | 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane |
| PubChem CID | 13307757 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane |
| SMILES | CC1(C2=CC=CC2)CCCO1 |
| InChI | InChI=1S/C10H14O/c1-10(7-4-8-11-10)9-5-2-3-6-9/h2-3,5H,4,6-8H2,1H3 |
| InChIKey | KIFVIFONXYMICD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane?
The IUPAC name of 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane (CID 13307757) is 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane.
What is the SMILES notation for 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane?
The canonical SMILES for 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane is CC1(C2=CC=CC2)CCCO1.
What is the InChIKey of 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane?
The InChIKey is KIFVIFONXYMICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-10(7-4-8-11-10)9-5-2-3-6-9/h2-3,5H,4,6-8H2,1H3.
What are the key properties of 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane?
2-cyclopenta-1,3-dien-1-yl-2-methyloxolane has a molecular weight of 150.22 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-1,3-dien-1-yl-2-methyloxolane is sourced from PubChem (CID 13307757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).