C24H33N3O4 — CID 133077944
(4S)-5-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-10-methyl-4-(2-methylpropyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-11-one (PubChem CID 133077944) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is (4S)-5-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-10-methyl-4-(2-methylpropyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-11-one.
| Compound Name | (4S)-5-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-10-methyl-4-(2-methylpropyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-11-one |
|---|---|
| PubChem CID | 133077944 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (4S)-5-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-10-methyl-4-(2-methylpropyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-11-one |
| SMILES | Cc1noc(C)c1C(=O)N1CCCCN(C)C(=O)c2ccccc2OC[C@@H]1CC(C)C |
| InChI | InChI=1S/C24H33N3O4/c1-16(2)14-19-15-30-21-11-7-6-10-20(21)23(28)26(5)12-8-9-13-27(19)24(29)22-17(3)25-31-18(22)4/h6-7,10-11,16,19H,8-9,12-15H2,1-5H3/t19-/m0/s1 |
| InChIKey | SILPVEAUQLHKQP-IBGZPJMESA-N |
| XLogP | 4.09 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |