C30H40N6O5 — CID 133078171
(7R,11S)-5-ethyl-7-(2-methylpropyl)-11-(4-pyridin-2-ylpiperazine-1-carbonyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-6,9,13-trione (PubChem CID 133078171) has the molecular formula C30H40N6O5 and a molecular weight of 564.69 g/mol. Its IUPAC name is (7R,11S)-5-ethyl-7-(2-methylpropyl)-11-(4-pyridin-2-ylpiperazine-1-carbonyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-6,9,13-trione.
| Compound Name | (7R,11S)-5-ethyl-7-(2-methylpropyl)-11-(4-pyridin-2-ylpiperazine-1-carbonyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-6,9,13-trione |
|---|---|
| PubChem CID | 133078171 |
| Molecular Formula | C30H40N6O5 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | (7R,11S)-5-ethyl-7-(2-methylpropyl)-11-(4-pyridin-2-ylpiperazine-1-carbonyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-6,9,13-trione |
| SMILES | CCN1CCOc2ccccc2C(=O)N[C@H](C(=O)N2CCN(c3ccccn3)CC2)CC(=O)N[C@H](CC(C)C)C1=O |
| InChI | InChI=1S/C30H40N6O5/c1-4-34-17-18-41-25-10-6-5-9-22(25)28(38)33-24(20-27(37)32-23(29(34)39)19-21(2)3)30(40)36-15-13-35(14-16-36)26-11-7-8-12-31-26/h5-12,21,23-24H,4,13-20H2,1-3H3,(H,32,37)(H,33,38)/t23-,24+/m1/s1 |
| InChIKey | WQWZYEZDYVSHRT-RPWUZVMVSA-N |
| XLogP | 1.69 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |