C34H43FN4O6 — CID 133078865
(4R,7S,14S)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(2-methylpropyl)-6,12,16-trioxo-2-oxa-5,11,15-triazatricyclo[15.4.0.07,11]henicosa-1(21),17,19-triene-14-carboxamide (PubChem CID 133078865) has the molecular formula C34H43FN4O6 and a molecular weight of 622.74 g/mol. Its IUPAC name is (4R,7S,14S)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(2-methylpropyl)-6,12,16-trioxo-2-oxa-5,11,15-triazatricyclo[15.4.0.07,11]henicosa-1(21),17,19-triene-14-carboxamide.
| Compound Name | (4R,7S,14S)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(2-methylpropyl)-6,12,16-trioxo-2-oxa-5,11,15-triazatricyclo[15.4.0.07,11]henicosa-1(21),17,19-triene-14-carboxamide |
|---|---|
| PubChem CID | 133078865 |
| Molecular Formula | C34H43FN4O6 |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | (4R,7S,14S)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(2-methylpropyl)-6,12,16-trioxo-2-oxa-5,11,15-triazatricyclo[15.4.0.07,11]henicosa-1(21),17,19-triene-14-carboxamide |
| SMILES | CC(C)C[C@@H]1COc2ccccc2C(=O)N[C@H](C(=O)NCC2(c3cccc(F)c3)CCOCC2)CC(=O)N2CCC[C@H]2C(=O)N1 |
| InChI | InChI=1S/C34H43FN4O6/c1-22(2)17-25-20-45-29-11-4-3-9-26(29)31(41)38-27(19-30(40)39-14-6-10-28(39)33(43)37-25)32(42)36-21-34(12-15-44-16-13-34)23-7-5-8-24(35)18-23/h3-5,7-9,11,18,22,25,27-28H,6,10,12-17,19-21H2,1-2H3,(H,36,42)(H,37,43)(H,38,41)/t25-,27+,28+/m1/s1 |
| InChIKey | KOUQRQXODXPYOD-PKXQUSJVSA-N |
| XLogP | 3.09 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |