About 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline
4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline (PubChem CID 133080664) has the molecular formula C9H9N3O3S
and a molecular weight of 239.26 g/mol. Its IUPAC name is 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline.
Molecular Properties
| Compound Name | 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline |
| PubChem CID | 133080664 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline |
| SMILES | CS(=O)(=O)c1nnc(-c2ccc(N)cc2)o1 |
| InChI | InChI=1S/C9H9N3O3S/c1-16(13,14)9-12-11-8(15-9)6-2-4-7(10)5-3-6/h2-5H,10H2,1H3 |
| InChIKey | ULORBWQDLLOPLY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline?
The IUPAC name of 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline (CID 133080664) is 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline.
What is the SMILES notation for 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline?
The canonical SMILES for 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline is CS(=O)(=O)c1nnc(-c2ccc(N)cc2)o1.
What is the InChIKey of 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline?
The InChIKey is ULORBWQDLLOPLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3S/c1-16(13,14)9-12-11-8(15-9)6-2-4-7(10)5-3-6/h2-5H,10H2,1H3.
What are the key properties of 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline?
4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline has a molecular weight of 239.26 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline is sourced from PubChem (CID 133080664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).