About 3-chloro-2,6-difluoropyridine-4-carbonitrile
3-chloro-2,6-difluoropyridine-4-carbonitrile (PubChem CID 133081070) has the molecular formula C6HClF2N2
and a molecular weight of 174.54 g/mol. Its IUPAC name is 3-chloro-2,6-difluoropyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-chloro-2,6-difluoropyridine-4-carbonitrile |
| PubChem CID | 133081070 |
| Molecular Formula | C6HClF2N2 |
| Molecular Weight | 174.54 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | 3-chloro-2,6-difluoropyridine-4-carbonitrile |
| SMILES | N#Cc1cc(F)nc(F)c1Cl |
| InChI | InChI=1S/C6HClF2N2/c7-5-3(2-10)1-4(8)11-6(5)9/h1H |
| InChIKey | JRKGUJVCBSYHLP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,6-difluoropyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,6-difluoropyridine-4-carbonitrile?
The IUPAC name of 3-chloro-2,6-difluoropyridine-4-carbonitrile (CID 133081070) is 3-chloro-2,6-difluoropyridine-4-carbonitrile.
What is the SMILES notation for 3-chloro-2,6-difluoropyridine-4-carbonitrile?
The canonical SMILES for 3-chloro-2,6-difluoropyridine-4-carbonitrile is N#Cc1cc(F)nc(F)c1Cl.
What is the InChIKey of 3-chloro-2,6-difluoropyridine-4-carbonitrile?
The InChIKey is JRKGUJVCBSYHLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HClF2N2/c7-5-3(2-10)1-4(8)11-6(5)9/h1H.
What are the key properties of 3-chloro-2,6-difluoropyridine-4-carbonitrile?
3-chloro-2,6-difluoropyridine-4-carbonitrile has a molecular weight of 174.54 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,6-difluoropyridine-4-carbonitrile is sourced from PubChem (CID 133081070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).