About phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate
phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate (PubChem CID 133081424) has the molecular formula C21H16FN5O2
and a molecular weight of 389.39 g/mol. Its IUPAC name is phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate.
Molecular Properties
| Compound Name | phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate |
| PubChem CID | 133081424 |
| Molecular Formula | C21H16FN5O2 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate |
| SMILES | O=C(Oc1ccccc1)n1nc(-c2cccnc2)nc1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H16FN5O2/c22-17-10-8-15(9-11-17)13-24-20-25-19(16-5-4-12-23-14-16)26-27(20)21(28)29-18-6-2-1-3-7-18/h1-12,14H,13H2,(H,24,25,26) |
| InChIKey | DBYUARKMKHIEDM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate?
The IUPAC name of phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate (CID 133081424) is phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate.
What is the SMILES notation for phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate?
The canonical SMILES for phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate is O=C(Oc1ccccc1)n1nc(-c2cccnc2)nc1NCc1ccc(F)cc1.
What is the InChIKey of phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate?
The InChIKey is DBYUARKMKHIEDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16FN5O2/c22-17-10-8-15(9-11-17)13-24-20-25-19(16-5-4-12-23-14-16)26-27(20)21(28)29-18-6-2-1-3-7-18/h1-12,14H,13H2,(H,24,25,26).
What are the key properties of phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate?
phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate has a molecular weight of 389.39 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 5-[(4-fluorophenyl)methylamino]-3-pyridin-3-yl-1,2,4-triazole-1-carboxylate is sourced from PubChem (CID 133081424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).