C21H28O2 — CID 133081875
1,1,1',1'-tetramethyl-3,3'-spirobi[3a,7a-dihydro-2H-indene]-5,5'-diol (PubChem CID 133081875) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 1,1,1',1'-tetramethyl-3,3'-spirobi[3a,7a-dihydro-2H-indene]-5,5'-diol.
| Compound Name | 1,1,1',1'-tetramethyl-3,3'-spirobi[3a,7a-dihydro-2H-indene]-5,5'-diol |
|---|---|
| PubChem CID | 133081875 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1,1,1',1'-tetramethyl-3,3'-spirobi[3a,7a-dihydro-2H-indene]-5,5'-diol |
| SMILES | CC1(C)CC2(CC(C)(C)C3C=CC(O)=CC32)C2C=C(O)C=CC21 |
| InChI | InChI=1S/C21H28O2/c1-19(2)11-21(17-9-13(22)5-7-15(17)19)12-20(3,4)16-8-6-14(23)10-18(16)21/h5-10,15-18,22-23H,11-12H2,1-4H3 |
| InChIKey | DIQLMURKXNKOCO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |